C17H20ClFN2O4S — CID 46457742
3-chloro-2-fluoro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide (PubChem CID 46457742) has the molecular formula C17H20ClFN2O4S and a molecular weight of 402.88 g/mol. Its IUPAC name is 3-chloro-2-fluoro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide.
| Compound Name | 3-chloro-2-fluoro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46457742 |
| Molecular Formula | C17H20ClFN2O4S |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-chloro-2-fluoro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(CNS(=O)(=O)c2cccc(Cl)c2F)N2CCOCC2)o1 |
| InChI | InChI=1S/C17H20ClFN2O4S/c1-12-5-6-15(25-12)14(21-7-9-24-10-8-21)11-20-26(22,23)16-4-2-3-13(18)17(16)19/h2-6,14,20H,7-11H2,1H3 |
| InChIKey | KIZFWMNXYJECSQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |