C19H35N3O4S — CID 51946495
4-[(1R)-2-(dibutylsulfamoylamino)-1-(5-methylfuran-2-yl)ethyl]morpholine (PubChem CID 51946495) has the molecular formula C19H35N3O4S and a molecular weight of 401.57 g/mol. Its IUPAC name is 4-[(1R)-2-(dibutylsulfamoylamino)-1-(5-methylfuran-2-yl)ethyl]morpholine.
| Compound Name | 4-[(1R)-2-(dibutylsulfamoylamino)-1-(5-methylfuran-2-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 51946495 |
| Molecular Formula | C19H35N3O4S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 4-[(1R)-2-(dibutylsulfamoylamino)-1-(5-methylfuran-2-yl)ethyl]morpholine |
| SMILES | CCCCN(CCCC)S(=O)(=O)NC[C@H](c1ccc(C)o1)N1CCOCC1 |
| InChI | InChI=1S/C19H35N3O4S/c1-4-6-10-22(11-7-5-2)27(23,24)20-16-18(19-9-8-17(3)26-19)21-12-14-25-15-13-21/h8-9,18,20H,4-7,10-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | MRTVNNHIGMFONE-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |