C17H20BrClN2O4S — CID 46657947
4-bromo-2-chloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide (PubChem CID 46657947) has the molecular formula C17H20BrClN2O4S and a molecular weight of 463.78 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46657947 |
| Molecular Formula | C17H20BrClN2O4S |
| Molecular Weight | 463.78 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 4-bromo-2-chloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(CNS(=O)(=O)c2ccc(Br)cc2Cl)N2CCOCC2)o1 |
| InChI | InChI=1S/C17H20BrClN2O4S/c1-12-2-4-16(25-12)15(21-6-8-24-9-7-21)11-20-26(22,23)17-5-3-13(18)10-14(17)19/h2-5,10,15,20H,6-9,11H2,1H3 |
| InChIKey | QHFBOCIMUWFSOE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |