C27H31N3O6S — CID 4646786
[2-[4-(diethylamino)anilino]-2-oxoethyl] 5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzoate (PubChem CID 4646786) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] 5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzoate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 4646786 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzoate |
| SMILES | CCN(CC)c1ccc(NC(=O)COC(=O)c2cc(S(=O)(=O)Nc3ccc(OC)cc3)ccc2C)cc1 |
| InChI | InChI=1S/C27H31N3O6S/c1-5-30(6-2)22-12-8-20(9-13-22)28-26(31)18-36-27(32)25-17-24(16-7-19(25)3)37(33,34)29-21-10-14-23(35-4)15-11-21/h7-17,29H,5-6,18H2,1-4H3,(H,28,31) |
| InChIKey | QWNGLZNCAAFGAU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|