C19H18N4O4S2 — CID 46468648
N-[4-[2-[3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 46468648) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[4-[2-[3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-[3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46468648 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[4-[2-[3-(methylsulfamoyl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)Cc2csc(NC(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-20-29(26,27)16-9-5-8-14(10-16)21-17(24)11-15-12-28-19(22-15)23-18(25)13-6-3-2-4-7-13/h2-10,12,20H,11H2,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | LDICYWIZHLVISS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |