C25H22N2O2S2 — CID 46477730
N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 46477730) has the molecular formula C25H22N2O2S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 46477730 |
| Molecular Formula | C25H22N2O2S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C25H22N2O2S2/c28-25(23-11-1-2-12-24(23)31-18-22-10-6-14-30-22)27-16-19-7-5-9-21(15-19)29-17-20-8-3-4-13-26-20/h1-15H,16-18H2,(H,27,28) |
| InChIKey | AAVMYIZIVWPBKG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |