C20H22N2O5S — CID 46480929
N-[3-[2-(2-methyl-5-methylsulfonylanilino)-2-oxoethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 46480929) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[3-[2-(2-methyl-5-methylsulfonylanilino)-2-oxoethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-(2-methyl-5-methylsulfonylanilino)-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46480929 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[3-[2-(2-methyl-5-methylsulfonylanilino)-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC(=O)COc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C20H22N2O5S/c1-13-6-9-17(28(2,25)26)11-18(13)22-19(23)12-27-16-5-3-4-15(10-16)21-20(24)14-7-8-14/h3-6,9-11,14H,7-8,12H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | IVORTRMKXGFDHL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |