C19H19F3N2O3 — CID 46485290
3-acetamido-4-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide (PubChem CID 46485290) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-acetamido-4-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide.
| Compound Name | 3-acetamido-4-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 46485290 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 3-acetamido-4-methyl-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]benzamide |
| SMILES | CC(=O)Nc1cc(C(=O)NC(C)c2ccc(OC(F)(F)F)cc2)ccc1C |
| InChI | InChI=1S/C19H19F3N2O3/c1-11-4-5-15(10-17(11)24-13(3)25)18(26)23-12(2)14-6-8-16(9-7-14)27-19(20,21)22/h4-10,12H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | FRQLNSHPCUSWIG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |