C19H19ClF3N3O5 — CID 46490672
5-chloro-N'-[2-(4-ethoxyphenoxy)propanoyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide (PubChem CID 46490672) has the molecular formula C19H19ClF3N3O5 and a molecular weight of 461.82 g/mol. Its IUPAC name is 5-chloro-N'-[2-(4-ethoxyphenoxy)propanoyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide.
| Compound Name | 5-chloro-N'-[2-(4-ethoxyphenoxy)propanoyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 46490672 |
| Molecular Formula | C19H19ClF3N3O5 |
| Molecular Weight | 461.82 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 5-chloro-N'-[2-(4-ethoxyphenoxy)propanoyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2cnc(OCC(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H19ClF3N3O5/c1-3-29-13-4-6-14(7-5-13)31-11(2)16(27)25-26-17(28)12-8-15(20)18(24-9-12)30-10-19(21,22)23/h4-9,11H,3,10H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ANXYIMPPRSLCBR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|