C20H21N3O2 — CID 46497719
N-(2,4-dimethylphenyl)-2,7,8-trimethyl-5-nitroquinolin-4-amine (PubChem CID 46497719) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2,7,8-trimethyl-5-nitroquinolin-4-amine.
| Compound Name | N-(2,4-dimethylphenyl)-2,7,8-trimethyl-5-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 46497719 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2,7,8-trimethyl-5-nitroquinolin-4-amine |
| SMILES | Cc1ccc(Nc2cc(C)nc3c(C)c(C)cc([N+](=O)[O-])c23)c(C)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-11-6-7-16(13(3)8-11)22-17-10-14(4)21-20-15(5)12(2)9-18(19(17)20)23(24)25/h6-10H,1-5H3,(H,21,22) |
| InChIKey | MORMZPOPNSADAK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|