C13H16Br3N3O — CID 46501976
N-[(E)-3-methylbutan-2-ylideneamino]-2-(2,4,5-tribromoanilino)acetamide (PubChem CID 46501976) has the molecular formula C13H16Br3N3O and a molecular weight of 470.00 g/mol. Its IUPAC name is N-[(E)-3-methylbutan-2-ylideneamino]-2-(2,4,5-tribromoanilino)acetamide.
| Compound Name | N-[(E)-3-methylbutan-2-ylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
|---|---|
| PubChem CID | 46501976 |
| Molecular Formula | C13H16Br3N3O |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 466.88 |
| IUPAC Name | N-[(E)-3-methylbutan-2-ylideneamino]-2-(2,4,5-tribromoanilino)acetamide |
| SMILES | C/C(=N\NC(=O)CNc1cc(Br)c(Br)cc1Br)C(C)C |
| InChI | InChI=1S/C13H16Br3N3O/c1-7(2)8(3)18-19-13(20)6-17-12-5-10(15)9(14)4-11(12)16/h4-5,7,17H,6H2,1-3H3,(H,19,20)/b18-8+ |
| InChIKey | YOXZEQWPACQRED-QGMBQPNBSA-N |
| XLogP | 4.53 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|