C23H22ClN3O6 — CID 46502328
N-[2-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 46502328) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is N-[2-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46502328 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[2-[(2E)-2-[[5-(4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)N/N=C/c2ccc(-c3ccc(Cl)cc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22ClN3O6/c1-30-19-10-15(11-20(31-2)22(19)32-3)23(29)25-13-21(28)27-26-12-17-8-9-18(33-17)14-4-6-16(24)7-5-14/h4-12H,13H2,1-3H3,(H,25,29)(H,27,28)/b26-12+ |
| InChIKey | CQOZNSAAQPAYOI-RPPGKUMJSA-N |
| XLogP | 3.51 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|