C19H20N2O4S — CID 46506395
dimethyl 2-[[benzyl(methyl)carbamothioyl]amino]benzene-1,4-dicarboxylate (PubChem CID 46506395) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is dimethyl 2-[[benzyl(methyl)carbamothioyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[benzyl(methyl)carbamothioyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 46506395 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | dimethyl 2-[[benzyl(methyl)carbamothioyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=S)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-21(12-13-7-5-4-6-8-13)19(26)20-16-11-14(17(22)24-2)9-10-15(16)18(23)25-3/h4-11H,12H2,1-3H3,(H,20,26) |
| InChIKey | BUKUTAAUHOJGFP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|