C20H27N3O5S — CID 46510440
N-[1-[3-(butylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide (PubChem CID 46510440) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[1-[3-(butylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[3-(butylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46510440 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[1-[3-(butylsulfamoyl)anilino]-3-methyl-1-oxobutan-2-yl]furan-2-carboxamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)C(NC(=O)c2ccco2)C(C)C)c1 |
| InChI | InChI=1S/C20H27N3O5S/c1-4-5-11-21-29(26,27)16-9-6-8-15(13-16)22-20(25)18(14(2)3)23-19(24)17-10-7-12-28-17/h6-10,12-14,18,21H,4-5,11H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | RLJFUFSZLAHNNR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|