C18H19N3O3 — CID 46513991
2-(3-methylphenoxy)ethyl 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 46513991) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | 2-(3-methylphenoxy)ethyl 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 46513991 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 1,3-dimethylpyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | Cc1cccc(OCCOC(=O)c2cnc3c(c2)c(C)nn3C)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-12-5-4-6-15(9-12)23-7-8-24-18(22)14-10-16-13(2)20-21(3)17(16)19-11-14/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | ZBPOYTKNTCNZSN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|