C23H27N5O5 — CID 46549204
5-[[(4-butoxy-3-methoxybenzoyl)amino]carbamoyl]-2-phenyl-3,4-dihydropyrazole-3-carboxamide (PubChem CID 46549204) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 5-[[(4-butoxy-3-methoxybenzoyl)amino]carbamoyl]-2-phenyl-3,4-dihydropyrazole-3-carboxamide.
| Compound Name | 5-[[(4-butoxy-3-methoxybenzoyl)amino]carbamoyl]-2-phenyl-3,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46549204 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 5-[[(4-butoxy-3-methoxybenzoyl)amino]carbamoyl]-2-phenyl-3,4-dihydropyrazole-3-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)C2=NN(c3ccccc3)C(C(N)=O)C2)cc1OC |
| InChI | InChI=1S/C23H27N5O5/c1-3-4-12-33-19-11-10-15(13-20(19)32-2)22(30)25-26-23(31)17-14-18(21(24)29)28(27-17)16-8-6-5-7-9-16/h5-11,13,18H,3-4,12,14H2,1-2H3,(H2,24,29)(H,25,30)(H,26,31) |
| InChIKey | PEJZAOCPQBOHBO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|