C24H22N4O3 — CID 46554386
3,5-diacetamido-N-(benzhydrylideneamino)benzamide (PubChem CID 46554386) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3,5-diacetamido-N-(benzhydrylideneamino)benzamide.
| Compound Name | 3,5-diacetamido-N-(benzhydrylideneamino)benzamide |
|---|---|
| PubChem CID | 46554386 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3,5-diacetamido-N-(benzhydrylideneamino)benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)NN=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H22N4O3/c1-16(29)25-21-13-20(14-22(15-21)26-17(2)30)24(31)28-27-23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15H,1-2H3,(H,25,29)(H,26,30)(H,28,31) |
| InChIKey | AGFMWGSZITXFSI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|