C24H20ClFN4O3S — CID 46555672
N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 46555672) has the molecular formula C24H20ClFN4O3S and a molecular weight of 498.97 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46555672 |
| Molecular Formula | C24H20ClFN4O3S |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H20ClFN4O3S/c1-14-21(15(2)30(28-14)19-9-7-18(26)8-10-19)22(31)27-11-12-29-23(32)20(34-24(29)33)13-16-3-5-17(25)6-4-16/h3-10,13H,11-12H2,1-2H3,(H,27,31)/b20-13- |
| InChIKey | UIJXRZHMDRCDGN-MOSHPQCFSA-N |
| XLogP | 4.75 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|