C29H27N3O5 — CID 46565896
N-[[4-(cyclopropylcarbamoyl)phenyl]methyl]-2-(4-ethoxyphenyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 46565896) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[[4-(cyclopropylcarbamoyl)phenyl]methyl]-2-(4-ethoxyphenyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[[4-(cyclopropylcarbamoyl)phenyl]methyl]-2-(4-ethoxyphenyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 46565896 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[[4-(cyclopropylcarbamoyl)phenyl]methyl]-2-(4-ethoxyphenyl)-N-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)c3ccc(C(=O)N(C)Cc4ccc(C(=O)NC5CC5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O5/c1-3-37-23-13-11-22(12-14-23)32-28(35)24-15-8-20(16-25(24)29(32)36)27(34)31(2)17-18-4-6-19(7-5-18)26(33)30-21-9-10-21/h4-8,11-16,21H,3,9-10,17H2,1-2H3,(H,30,33) |
| InChIKey | ZGEVBLJMRYDKPT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|