C21H24N4O3S2 — CID 46567799
2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 46567799) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 46567799 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CCn1c(SC(C)C(=O)Nc2ccc(N3CCOCC3)cc2)nc2ccsc2c1=O |
| InChI | InChI=1S/C21H24N4O3S2/c1-3-25-20(27)18-17(8-13-29-18)23-21(25)30-14(2)19(26)22-15-4-6-16(7-5-15)24-9-11-28-12-10-24/h4-8,13-14H,3,9-12H2,1-2H3,(H,22,26) |
| InChIKey | JZLGPYSOQBQUHK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|