C25H24N4O3S2 — CID 24654244
N-(4-morpholin-4-ylphenyl)-2-(4-oxo-3-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 24654244) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-(4-oxo-3-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-(4-oxo-3-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 24654244 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-(4-oxo-3-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | CC(Sc1nc2sccc2c(=O)n1-c1ccccc1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-17(22(30)26-18-7-9-19(10-8-18)28-12-14-32-15-13-28)34-25-27-23-21(11-16-33-23)24(31)29(25)20-5-3-2-4-6-20/h2-11,16-17H,12-15H2,1H3,(H,26,30) |
| InChIKey | FBGPMQIBDDRDDI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|