C15H15N3O2S2 — CID 46575595
3-[2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]ethyl]imidazolidine-2,4-dione (PubChem CID 46575595) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-[2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46575595 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-[2-[(2-phenyl-1,3-thiazol-4-yl)methylsulfanyl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCSCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N3O2S2/c19-13-8-16-15(20)18(13)6-7-21-9-12-10-22-14(17-12)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,16,20) |
| InChIKey | QPFVMNOSZVABSI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|