C17H19ClN4O4 — CID 46602739
[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 46602739) has the molecular formula C17H19ClN4O4 and a molecular weight of 378.82 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 46602739 |
| Molecular Formula | C17H19ClN4O4 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C)OC(=O)CN(C)c1ncccn1 |
| InChI | InChI=1S/C17H19ClN4O4/c1-11(16(24)21-13-9-12(18)5-6-14(13)25-3)26-15(23)10-22(2)17-19-7-4-8-20-17/h4-9,11H,10H2,1-3H3,(H,21,24) |
| InChIKey | HIQXWNJWTDYLDA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |