C15H19FN2O5 — CID 46609589
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 46609589) has the molecular formula C15H19FN2O5 and a molecular weight of 326.32 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 46609589 |
| Molecular Formula | C15H19FN2O5 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OC(C(=O)NC(N)=O)C(C)C)cc1F |
| InChI | InChI=1S/C15H19FN2O5/c1-8(2)13(14(20)18-15(17)21)23-12(19)7-9-4-5-11(22-3)10(16)6-9/h4-6,8,13H,7H2,1-3H3,(H3,17,18,20,21) |
| InChIKey | WZUNXZKAAIHTFA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |