C17H24N2O2S — CID 4662250
ethyl 1-[(4-ethylphenyl)carbamothioyl]piperidine-4-carboxylate (PubChem CID 4662250) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is ethyl 1-[(4-ethylphenyl)carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-ethylphenyl)carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4662250 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl 1-[(4-ethylphenyl)carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=S)Nc2ccc(CC)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O2S/c1-3-13-5-7-15(8-6-13)18-17(22)19-11-9-14(10-12-19)16(20)21-4-2/h5-8,14H,3-4,9-12H2,1-2H3,(H,18,22) |
| InChIKey | ZSXNHWOVGZEGRW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|