C21H25N3O5S — CID 46637590
propan-2-yl 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)amino]-3-(4-methylphenyl)propanoate (PubChem CID 46637590) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is propan-2-yl 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)amino]-3-(4-methylphenyl)propanoate.
| Compound Name | propan-2-yl 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)amino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 46637590 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | propan-2-yl 3-[(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carbonyl)amino]-3-(4-methylphenyl)propanoate |
| SMILES | Cc1ccc(C(CC(=O)OC(C)C)NC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-14(2)29-20(25)12-18(16-6-4-15(3)5-7-16)22-21(26)17-8-9-19-23-30(27,28)11-10-24(19)13-17/h4-9,13-14,18H,10-12H2,1-3H3,(H,22,26) |
| InChIKey | HKFINQUFSJZZOX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |