About methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate
methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate (PubChem CID 46637636) has the molecular formula C25H26N2O5S
and a molecular weight of 466.56 g/mol. Its IUPAC name is methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate |
| PubChem CID | 46637636 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(NS(=O)(=O)c2cc(C)ccc2C)c1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O5S/c1-17-12-13-18(2)23(14-17)33(30,31)27-21-11-7-10-20(15-21)25(29)26-22(16-24(28)32-3)19-8-5-4-6-9-19/h4-15,22,27H,16H2,1-3H3,(H,26,29) |
| InChIKey | ZLNZGONIIMZXKV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate?
The IUPAC name of methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate (CID 46637636) is methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate.
What is the SMILES notation for methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate?
The canonical SMILES for methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate is COC(=O)CC(NC(=O)c1cccc(NS(=O)(=O)c2cc(C)ccc2C)c1)c1ccccc1.
What is the InChIKey of methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate?
The InChIKey is ZLNZGONIIMZXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O5S/c1-17-12-13-18(2)23(14-17)33(30,31)27-21-11-7-10-20(15-21)25(29)26-22(16-24(28)32-3)19-8-5-4-6-9-19/h4-15,22,27H,16H2,1-3H3,(H,26,29).
What are the key properties of methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate?
methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate has a molecular weight of 466.56 g/mol, XLogP of 4.14, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[3-[(2,5-dimethylphenyl)sulfonylamino]benzoyl]amino]-3-phenylpropanoate is sourced from PubChem (CID 46637636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).