C13H17N5O2S2 — CID 46645201
N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide (PubChem CID 46645201) has the molecular formula C13H17N5O2S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 46645201 |
| Molecular Formula | C13H17N5O2S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide |
| SMILES | C=CCNc1nnc(SC(CC)C(=O)Nc2cc(C)on2)s1 |
| InChI | InChI=1S/C13H17N5O2S2/c1-4-6-14-12-16-17-13(22-12)21-9(5-2)11(19)15-10-7-8(3)20-18-10/h4,7,9H,1,5-6H2,2-3H3,(H,14,16)(H,15,18,19) |
| InChIKey | QJHSMLIVUWSXGF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|