C14H19N5O2S2 — CID 17392705
N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanamide (PubChem CID 17392705) has the molecular formula C14H19N5O2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 17392705 |
| Molecular Formula | C14H19N5O2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]pentanamide |
| SMILES | C=CCNc1nnc(SC(CCC)C(=O)Nc2cc(C)on2)s1 |
| InChI | InChI=1S/C14H19N5O2S2/c1-4-6-10(12(20)16-11-8-9(3)21-19-11)22-14-18-17-13(23-14)15-7-5-2/h5,8,10H,2,4,6-7H2,1,3H3,(H,15,17)(H,16,19,20) |
| InChIKey | ALFKHSHPDRLNGP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|