C22H17N3O3 — CID 46662435
N'-(2-naphthalen-1-ylacetyl)-5-phenyl-1,2-oxazole-3-carbohydrazide (PubChem CID 46662435) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N'-(2-naphthalen-1-ylacetyl)-5-phenyl-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-(2-naphthalen-1-ylacetyl)-5-phenyl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46662435 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N'-(2-naphthalen-1-ylacetyl)-5-phenyl-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C22H17N3O3/c26-21(13-17-11-6-10-15-7-4-5-12-18(15)17)23-24-22(27)19-14-20(28-25-19)16-8-2-1-3-9-16/h1-12,14H,13H2,(H,23,26)(H,24,27) |
| InChIKey | DWVUPCNRZXKYFN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|