C27H25F2N3O4 — CID 46672266
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 46672266) has the molecular formula C27H25F2N3O4 and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 46672266 |
| Molecular Formula | C27H25F2N3O4 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | O=C(CN1C(=O)NC(Cc2ccccc2)(c2ccccc2)C1=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C27H25F2N3O4/c28-25(29)36-22-13-11-19(12-14-22)15-16-30-23(33)18-32-24(34)27(31-26(32)35,21-9-5-2-6-10-21)17-20-7-3-1-4-8-20/h1-14,25H,15-18H2,(H,30,33)(H,31,35) |
| InChIKey | WDOBQKHVPJKHLZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|