C18H21ClN4O5 — CID 46673272
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(1,3,5-trimethylpyrazol-4-yl)propanoate (PubChem CID 46673272) has the molecular formula C18H21ClN4O5 and a molecular weight of 408.84 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(1,3,5-trimethylpyrazol-4-yl)propanoate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(1,3,5-trimethylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 46673272 |
| Molecular Formula | C18H21ClN4O5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 3-(1,3,5-trimethylpyrazol-4-yl)propanoate |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)OC(C)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H21ClN4O5/c1-10-14(11(2)22(4)21-10)6-8-17(24)28-12(3)18(25)20-16-9-13(23(26)27)5-7-15(16)19/h5,7,9,12H,6,8H2,1-4H3,(H,20,25) |
| InChIKey | PJPSCFJNQFVWIJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|