C20H16F3N3O2 — CID 46677889
(E)-2-cyano-N-(4-ethylphenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide (PubChem CID 46677889) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-ethylphenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-ethylphenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46677889 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (E)-2-cyano-N-(4-ethylphenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)/C(C#N)=C/c2cccc(NC(=O)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-2-13-6-8-16(9-7-13)25-18(27)15(12-24)10-14-4-3-5-17(11-14)26-19(28)20(21,22)23/h3-11H,2H2,1H3,(H,25,27)(H,26,28)/b15-10+ |
| InChIKey | VTMVOXDDOLMOBD-XNTDXEJSSA-N |
| XLogP | 4.30 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|