C18H10Cl2F3N3O2 — CID 55480055
(E)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide (PubChem CID 55480055) has the molecular formula C18H10Cl2F3N3O2 and a molecular weight of 428.20 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55480055 |
| Molecular Formula | C18H10Cl2F3N3O2 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (E)-2-cyano-N-(2,4-dichlorophenyl)-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cccc(NC(=O)C(F)(F)F)c1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H10Cl2F3N3O2/c19-12-4-5-15(14(20)8-12)26-16(27)11(9-24)6-10-2-1-3-13(7-10)25-17(28)18(21,22)23/h1-8H,(H,25,28)(H,26,27)/b11-6+ |
| InChIKey | GAAFVWHNKXHQHX-IZZDOVSWSA-N |
| XLogP | 5.04 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|