C21H18F3N3O2 — CID 46677938
(E)-2-cyano-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 46677938) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46677938 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (E)-2-cyano-3-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C/c2cccc(NC(=O)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C21H18F3N3O2/c1-12-7-13(2)18(14(3)8-12)27-19(28)16(11-25)9-15-5-4-6-17(10-15)26-20(29)21(22,23)24/h4-10H,1-3H3,(H,26,29)(H,27,28)/b16-9+ |
| InChIKey | AFEDUQVCGAOHJQ-CXUHLZMHSA-N |
| XLogP | 4.66 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|