C17H12ClFN6OS — CID 46683618
N-(3-chloro-4-cyanophenyl)-3-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 46683618) has the molecular formula C17H12ClFN6OS and a molecular weight of 402.84 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-3-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-3-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46683618 |
| Molecular Formula | C17H12ClFN6OS |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-3-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | N#Cc1ccc(NC(=O)CCSc2nnnn2-c2cccc(F)c2)cc1Cl |
| InChI | InChI=1S/C17H12ClFN6OS/c18-15-9-13(5-4-11(15)10-20)21-16(26)6-7-27-17-22-23-24-25(17)14-3-1-2-12(19)8-14/h1-5,8-9H,6-7H2,(H,21,26) |
| InChIKey | BFPCULSWXRNWCK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |