C20H26N4O3 — CID 46702163
5-[[3-[(1S)-1-cyclopropylbut-3-enoxy]-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 46702163) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 5-[[3-[(1S)-1-cyclopropylbut-3-enoxy]-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[3-[(1S)-1-cyclopropylbut-3-enoxy]-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46702163 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 5-[[3-[(1S)-1-cyclopropylbut-3-enoxy]-4,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | C=CC[C@H](Oc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC)C1CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-5-15(13-6-7-13)27-17-10-12(9-16(25-2)18(17)26-3)8-14-11-23-20(22)24-19(14)21/h4,9-11,13,15H,1,5-8H2,2-3H3,(H4,21,22,23,24)/t15-/m0/s1 |
| InChIKey | VPKKZGCIWLEDEG-HNNXBMFYSA-N |
| XLogP | 2.98 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|