C31H44O6S2 — CID 46702201
(3S)-3-[2-[(2S,3S)-3-(ethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-phenylmethoxypentyl]-1,3-dithian-2-yl]butanal (PubChem CID 46702201) has the molecular formula C31H44O6S2 and a molecular weight of 576.82 g/mol. Its IUPAC name is (3S)-3-[2-[(2S,3S)-3-(ethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-phenylmethoxypentyl]-1,3-dithian-2-yl]butanal.
| Compound Name | (3S)-3-[2-[(2S,3S)-3-(ethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-phenylmethoxypentyl]-1,3-dithian-2-yl]butanal |
|---|---|
| PubChem CID | 46702201 |
| Molecular Formula | C31H44O6S2 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | (3S)-3-[2-[(2S,3S)-3-(ethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-2-phenylmethoxypentyl]-1,3-dithian-2-yl]butanal |
| SMILES | CCOCO[C@@H](CCOCc1ccc(OC)cc1)[C@H](CC1([C@@H](C)CC=O)SCCCS1)OCc1ccccc1 |
| InChI | InChI=1S/C31H44O6S2/c1-4-34-24-37-29(16-18-35-22-27-11-13-28(33-3)14-12-27)30(36-23-26-9-6-5-7-10-26)21-31(25(2)15-17-32)38-19-8-20-39-31/h5-7,9-14,17,25,29-30H,4,8,15-16,18-24H2,1-3H3/t25-,29-,30-/m0/s1 |
| InChIKey | DAWCFNXXOHSNLB-ARVREXMNSA-N |
| XLogP | 6.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|