C14H23NO7 — CID 46704325
methyl (3R,6R,7R,7aR)-3-tert-butyl-6,7-dihydroxy-6-(hydroxymethyl)-7-methyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 46704325) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is methyl (3R,6R,7R,7aR)-3-tert-butyl-6,7-dihydroxy-6-(hydroxymethyl)-7-methyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | methyl (3R,6R,7R,7aR)-3-tert-butyl-6,7-dihydroxy-6-(hydroxymethyl)-7-methyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 46704325 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | methyl (3R,6R,7R,7aR)-3-tert-butyl-6,7-dihydroxy-6-(hydroxymethyl)-7-methyl-5-oxo-1,3-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@H](C(C)(C)C)N1C(=O)[C@@](O)(CO)[C@]2(C)O |
| InChI | InChI=1S/C14H23NO7/c1-11(2,3)9-15-8(17)14(20,6-16)12(4,19)13(15,7-22-9)10(18)21-5/h9,16,19-20H,6-7H2,1-5H3/t9-,12-,13+,14+/m1/s1 |
| InChIKey | ZRDXRGNPCCCEMR-QQUHWDOBSA-N |
| XLogP | -1.38 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |