C15H18FN3O — CID 46705133
3-(3-fluorophenyl)-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 46705133) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46705133 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-(3-fluorophenyl)-1-methyl-N-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc(-c2cccc(F)c2)nn1C |
| InChI | InChI=1S/C15H18FN3O/c1-10(2)9-17-15(20)14-8-13(18-19(14)3)11-5-4-6-12(16)7-11/h4-8,10H,9H2,1-3H3,(H,17,20) |
| InChIKey | HYNVAPARJZJNQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |