About [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone
[2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone (PubChem CID 4672022) has the molecular formula C16H11F6NO3
and a molecular weight of 379.26 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone |
| PubChem CID | 4672022 |
| Molecular Formula | C16H11F6NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)n1cc(C(F)(F)F)c(C(F)(F)F)c1C1OCCO1 |
| InChI | InChI=1S/C16H11F6NO3/c17-15(18,19)10-8-23(13(24)9-4-2-1-3-5-9)12(11(10)16(20,21)22)14-25-6-7-26-14/h1-5,8,14H,6-7H2 |
| InChIKey | ZVZJAZCLHQXPSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone?
The IUPAC name of [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone (CID 4672022) is [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone.
What is the SMILES notation for [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone?
The canonical SMILES for [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone is O=C(c1ccccc1)n1cc(C(F)(F)F)c(C(F)(F)F)c1C1OCCO1.
What is the InChIKey of [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone?
The InChIKey is ZVZJAZCLHQXPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F6NO3/c17-15(18,19)10-8-23(13(24)9-4-2-1-3-5-9)12(11(10)16(20,21)22)14-25-6-7-26-14/h1-5,8,14H,6-7H2.
What are the key properties of [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone?
[2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone has a molecular weight of 379.26 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxolan-2-yl)-3,4-bis(trifluoromethyl)pyrrol-1-yl]-phenylmethanone is sourced from PubChem (CID 4672022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).