C15H16F9N — CID 4672414
N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptan-3-yl)aniline (PubChem CID 4672414) has the molecular formula C15H16F9N and a molecular weight of 381.28 g/mol. Its IUPAC name is N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptan-3-yl)aniline.
| Compound Name | N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptan-3-yl)aniline |
|---|---|
| PubChem CID | 4672414 |
| Molecular Formula | C15H16F9N |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-methyl-N-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methylheptan-3-yl)aniline |
| SMILES | CC(C)C(N(C)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H16F9N/c1-9(2)11(25(3)10-7-5-4-6-8-10)12(16,17)13(18,19)14(20,21)15(22,23)24/h4-9,11H,1-3H3 |
| InChIKey | ULPFYHVSHPDVCW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|