C20H21N3O3 — CID 46726291
4-ethyl-13,13-dimethyl-6-phenyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione (PubChem CID 46726291) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-ethyl-13,13-dimethyl-6-phenyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione.
| Compound Name | 4-ethyl-13,13-dimethyl-6-phenyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione |
|---|---|
| PubChem CID | 46726291 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-ethyl-13,13-dimethyl-6-phenyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7-dione |
| SMILES | CCn1c(=O)n(-c2ccccc2)c(=O)c2cc3c(nc21)CC(C)(C)OC3 |
| InChI | InChI=1S/C20H21N3O3/c1-4-22-17-15(10-13-12-26-20(2,3)11-16(13)21-17)18(24)23(19(22)25)14-8-6-5-7-9-14/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | UUMUTHYGJFFJCS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |