C19H11N3O6 — CID 4676222
2-[(2,4-dihydroxyphenyl)methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 4676222) has the molecular formula C19H11N3O6 and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[(2,4-dihydroxyphenyl)methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4676222 |
| Molecular Formula | C19H11N3O6 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)methylideneamino]-6-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c([N+](=O)[O-])ccc(c23)C(=O)N1N=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C19H11N3O6/c23-11-5-4-10(16(24)8-11)9-20-21-18(25)13-3-1-2-12-15(22(27)28)7-6-14(17(12)13)19(21)26/h1-9,23-24H |
| InChIKey | RTFCBWWPLNMOHZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|