C29H22N4O7 — CID 6907248
2-[2-methoxy-4-[(E)-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 6907248) has the molecular formula C29H22N4O7 and a molecular weight of 538.52 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6907248 |
| Molecular Formula | C29H22N4O7 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=N/N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C29H22N4O7/c1-17-6-9-19(10-7-17)31-26(34)16-40-24-13-8-18(14-25(24)39-2)15-30-32-28(35)21-5-3-4-20-23(33(37)38)12-11-22(27(20)21)29(32)36/h3-15H,16H2,1-2H3,(H,31,34)/b30-15+ |
| InChIKey | ARONCQRSKLHVGF-FJEPWZHXSA-N |
| XLogP | 4.71 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|