C12H24N4 — CID 46784303
N',N'-dimethyl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]propane-1,3-diamine (PubChem CID 46784303) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 46784303 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N',N'-dimethyl-N-[(1,4,5-trimethylimidazol-2-yl)methyl]propane-1,3-diamine |
| SMILES | Cc1nc(CNCCCN(C)C)n(C)c1C |
| InChI | InChI=1S/C12H24N4/c1-10-11(2)16(5)12(14-10)9-13-7-6-8-15(3)4/h13H,6-9H2,1-5H3 |
| InChIKey | GCWKAVBOULPBNJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|