C13H18N8O4 — CID 46786161
1-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 46786161) has the molecular formula C13H18N8O4 and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46786161 |
| Molecular Formula | C13H18N8O4 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[(4-amino-6-morpholin-4-yl-1,3,5-triazin-2-yl)methyl]-3,5-dimethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(C)c(=O)n(Cc2nc(N)nc(N3CCOCC3)n2)c1=O |
| InChI | InChI=1S/C13H18N8O4/c1-18-11(22)19(2)13(24)21(12(18)23)7-8-15-9(14)17-10(16-8)20-3-5-25-6-4-20/h3-7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | PMDXYIPEUZTELF-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |