C19H16Cl3NO5 — CID 46793915
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(4-acetylphenoxy)acetate (PubChem CID 46793915) has the molecular formula C19H16Cl3NO5 and a molecular weight of 444.70 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(4-acetylphenoxy)acetate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(4-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 46793915 |
| Molecular Formula | C19H16Cl3NO5 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-(4-acetylphenoxy)acetate |
| SMILES | CC(=O)c1ccc(OCC(=O)OC(C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl3NO5/c1-10(24)12-3-5-13(6-4-12)27-9-18(25)28-11(2)19(26)23-17-8-15(21)14(20)7-16(17)22/h3-8,11H,9H2,1-2H3,(H,23,26) |
| InChIKey | GJRZSVDVSBBOQO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|