C16H19NO5 — CID 8638473
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(4-acetylphenoxy)acetate (PubChem CID 8638473) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(4-acetylphenoxy)acetate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(4-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 8638473 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(4-acetylphenoxy)acetate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)COc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H19NO5/c1-4-9-17-16(20)12(3)22-15(19)10-21-14-7-5-13(6-8-14)11(2)18/h4-8,12H,1,9-10H2,2-3H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | ALOAIGOVJMGVBF-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|