C23H25N3O3S — CID 46794172
[1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 46794172) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 46794172 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [1-(2-butan-2-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | CCC(C)c1ccccc1NC(=O)C(C)OC(=O)CSc1cnc2ccccc2n1 |
| InChI | InChI=1S/C23H25N3O3S/c1-4-15(2)17-9-5-6-10-18(17)26-23(28)16(3)29-22(27)14-30-21-13-24-19-11-7-8-12-20(19)25-21/h5-13,15-16H,4,14H2,1-3H3,(H,26,28) |
| InChIKey | UNSAXGCRVDBFCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |